In the title molecule, C19H19Cl2NO2, the angle between the mean planes of the 2,4-dichlorophenyl and 2-hydroxyphenyl groups is 81.8 (2)°. The ketone oxygen of the prop-2-en-1-one group is twisted in a synclinal conformation with the 2,4-dichlorophenyl group [torsion angle = −75.7 (2)°]. The two diethyl extensions from the 4-(diethylamino)-2-hydroxyphenyl group are twisted in anti- and syn-periplanar conformations. Crystal packing is stabilized by intermolecular C—H⋯O hydrogen bonding between the ketone O atom from the prop-2-en-1-one group and H atoms from both the 2-hydroxyphenyl ring and the hydroxy group; these hydrogen bonds link the molecules into chains along the diagonal of the bc face of the unit cell. The 2-hydroxyphenyl...
In the title compound, C22H19ClN2O3S, the dihedral angle between the mean planes of the thiophene r...
The title compound, C18H20N2O3, crystallizes as the keto tautomer, unlike the vast majority of simil...
In the title molecule, C16H11BrCl2O2, the angle between the mean planes of the 2,4-dichlorophenyl ...
In the title molecule, C18H14Cl4O2, the angle between the mean planes of the 3,5-dichloro-4-methox...
In the title compound, C23H17Cl3O2, the dihedral angles between the 2-chlorophenyl group and the tw...
In the title molecule, C17H18Cl2N2O, the angle between the mean planes of the 2,5-dichlorophenyli...
In the title molecule, C17H20N2O2, the angle between the mean planes of the 3-hydroxyphenyl and cy...
The title molecule, C21H15Cl2N3O, consists of two coplanar 4-chlorophenyl groups bonded to a disto...
In the title molecule, C21H22N2O, the angle between the mean planes of the 1-naphthylimino and 2-m...
In the title molecule, C21H19ClF3NO2, the 5-chlorophenyl and 4-methoxybenzyl groups are twisted s...
In the title compound, C17H12Br3Cl2NO, the mean planes of the 3,5-dibromo-4-phenyl and 2,4-dichloro...
In the title compound, C14H13NO, which has two molecules in the asymmetric unit, the dihedral angle...
In the title salt, C(21)H(24)ClFNO(2)(+)center dot C(6)H(2)N(3)O(7)(-), the dihedral angle between t...
Two new chalcones of general type (2E)-1-(3-hydroxyphenyl)-3-(4-R-phenyl)prop-2-en-1-one are repo...
In the title salt, C21H24ClFNO2+·C6H2N3O7−, the dihedral angle between the aromatic rings in the cat...
In the title compound, C22H19ClN2O3S, the dihedral angle between the mean planes of the thiophene r...
The title compound, C18H20N2O3, crystallizes as the keto tautomer, unlike the vast majority of simil...
In the title molecule, C16H11BrCl2O2, the angle between the mean planes of the 2,4-dichlorophenyl ...
In the title molecule, C18H14Cl4O2, the angle between the mean planes of the 3,5-dichloro-4-methox...
In the title compound, C23H17Cl3O2, the dihedral angles between the 2-chlorophenyl group and the tw...
In the title molecule, C17H18Cl2N2O, the angle between the mean planes of the 2,5-dichlorophenyli...
In the title molecule, C17H20N2O2, the angle between the mean planes of the 3-hydroxyphenyl and cy...
The title molecule, C21H15Cl2N3O, consists of two coplanar 4-chlorophenyl groups bonded to a disto...
In the title molecule, C21H22N2O, the angle between the mean planes of the 1-naphthylimino and 2-m...
In the title molecule, C21H19ClF3NO2, the 5-chlorophenyl and 4-methoxybenzyl groups are twisted s...
In the title compound, C17H12Br3Cl2NO, the mean planes of the 3,5-dibromo-4-phenyl and 2,4-dichloro...
In the title compound, C14H13NO, which has two molecules in the asymmetric unit, the dihedral angle...
In the title salt, C(21)H(24)ClFNO(2)(+)center dot C(6)H(2)N(3)O(7)(-), the dihedral angle between t...
Two new chalcones of general type (2E)-1-(3-hydroxyphenyl)-3-(4-R-phenyl)prop-2-en-1-one are repo...
In the title salt, C21H24ClFNO2+·C6H2N3O7−, the dihedral angle between the aromatic rings in the cat...
In the title compound, C22H19ClN2O3S, the dihedral angle between the mean planes of the thiophene r...
The title compound, C18H20N2O3, crystallizes as the keto tautomer, unlike the vast majority of simil...
In the title molecule, C16H11BrCl2O2, the angle between the mean planes of the 2,4-dichlorophenyl ...