In the title molecule, C17H20N2O2, the angle between the mean planes of the 3-hydroxyphenyl and cyclohexa-2,4-dien-1-one rings is 10.7 (7)°. Intramolecular N—H⋯O hydrogen bonding involving the amine H atom and the carbonyl O atom affects the conformation of the molecule. One of the ethyl arms is disordered over two conformations with occupancies of 0.766 (8) and 0.234 (8). Crystal packing is stabilized by intermolecular C—H⋯O hydrogen bonding between the major component of the disordered ethyl C atom and a nearby carbonyl O atom, and by O—H⋯O hydrogen bonding between the hydroxyl H atom and the carbonyl O atom. This links the molecules into chains in an alternate inverted pattern, parallel, oblique and diagonal to the bc face of the u...
In the cation of the title compound, C\sb 7H\sb 13N\sb 2\sp +⋅C\sb 6H\sb 2N\sb 3O\sb 7\sp -}}, the s...
The title compound, C28H19ClF2O2, is a polysubstituted terphenyl derivative bearing a Michael system...
In the title compound, C16H14N2O3 center dot 4H(2)O, the dihedral angle between the mean planes of t...
The title compound, C18H20N2O3, crystallizes as the keto tautomer, unlike the vast majority of simil...
In the title salt, C21H24ClFNO2+·C6H2N3O7−, the dihedral angle between the aromatic rings in the cat...
In the title salt, C(21)H(24)ClFNO(2)(+)center dot C(6)H(2)N(3)O(7)(-), the dihedral angle between t...
The title compound, C\sb 16H\sb 15N\sb 5, crystallizes with two independent mol\-ecules (\it A and \...
In the title compound, C22H19ClN2O3S, the dihedral angle between the mean planes of the thiophene r...
In the title molecule, C21H22N2O, the angle between the mean planes of the 1-naphthylimino and 2-m...
In the title molecule, C19H19Cl2NO2, the angle between the mean planes of the 2,4-dichlorophenyl a...
In the title molecule, C18H14Cl4O2, the angle between the mean planes of the 3,5-dichloro-4-methox...
The title molecule, C21H15Cl2N3O, consists of two coplanar 4-chlorophenyl groups bonded to a disto...
In the molecule of the title compound, C16H16N4O, the pyrazole ring makes dihedral angles of 8.52 (...
The title compound, C19H24N2O2, adopts the phenol-imine tautomeric form. An intramolecular O-H cente...
In the title compound (systematic name: (R)-dimethyl{2-[1-phenyl-1-(pyridin-2-yl)ethoxy]ethyl}aza...
In the cation of the title compound, C\sb 7H\sb 13N\sb 2\sp +⋅C\sb 6H\sb 2N\sb 3O\sb 7\sp -}}, the s...
The title compound, C28H19ClF2O2, is a polysubstituted terphenyl derivative bearing a Michael system...
In the title compound, C16H14N2O3 center dot 4H(2)O, the dihedral angle between the mean planes of t...
The title compound, C18H20N2O3, crystallizes as the keto tautomer, unlike the vast majority of simil...
In the title salt, C21H24ClFNO2+·C6H2N3O7−, the dihedral angle between the aromatic rings in the cat...
In the title salt, C(21)H(24)ClFNO(2)(+)center dot C(6)H(2)N(3)O(7)(-), the dihedral angle between t...
The title compound, C\sb 16H\sb 15N\sb 5, crystallizes with two independent mol\-ecules (\it A and \...
In the title compound, C22H19ClN2O3S, the dihedral angle between the mean planes of the thiophene r...
In the title molecule, C21H22N2O, the angle between the mean planes of the 1-naphthylimino and 2-m...
In the title molecule, C19H19Cl2NO2, the angle between the mean planes of the 2,4-dichlorophenyl a...
In the title molecule, C18H14Cl4O2, the angle between the mean planes of the 3,5-dichloro-4-methox...
The title molecule, C21H15Cl2N3O, consists of two coplanar 4-chlorophenyl groups bonded to a disto...
In the molecule of the title compound, C16H16N4O, the pyrazole ring makes dihedral angles of 8.52 (...
The title compound, C19H24N2O2, adopts the phenol-imine tautomeric form. An intramolecular O-H cente...
In the title compound (systematic name: (R)-dimethyl{2-[1-phenyl-1-(pyridin-2-yl)ethoxy]ethyl}aza...
In the cation of the title compound, C\sb 7H\sb 13N\sb 2\sp +⋅C\sb 6H\sb 2N\sb 3O\sb 7\sp -}}, the s...
The title compound, C28H19ClF2O2, is a polysubstituted terphenyl derivative bearing a Michael system...
In the title compound, C16H14N2O3 center dot 4H(2)O, the dihedral angle between the mean planes of t...